
CAS 201853-92-1
:Meosuc-Ala-Phe-Lys-Amc Tfa
Description:
Meosuc-Ala-Phe-Lys-Amc Tfa, identified by the CAS number 201853-92-1, is a synthetic peptide that serves as a substrate for various biochemical assays, particularly in the study of proteolytic enzymes. This compound is characterized by its specific amino acid sequence, which includes methionine sulfoxide (Meosuc), alanine (Ala), phenylalanine (Phe), lysine (Lys), and an amide group (Amc) that enhances its fluorescent properties. The presence of trifluoroacetic acid (Tfa) indicates that it is likely in a salt form, which is commonly used to stabilize peptides during synthesis and purification processes. The peptide's structure allows it to interact with enzymes, making it valuable in research related to enzyme kinetics and inhibition studies. Additionally, its fluorescent properties enable real-time monitoring of enzymatic reactions, providing insights into enzyme activity and function. Overall, Meosuc-Ala-Phe-Lys-Amc Tfa is a versatile tool in biochemical research, particularly in the fields of enzymology and molecular biology.
Formula:C35H42F3N5O10
InChI:InChI=1S/C33H41N5O8.C2HF3O2/c1-20-17-30(41)46-27-19-23(12-13-24(20)27)36-32(43)25(11-7-8-16-34)37-33(44)26(18-22-9-5-4-6-10-22)38-31(42)21(2)35-28(39)14-15-29(40)45-3;3-2(4,5)1(6)7/h4-6,9-10,12-13,17,19,21,25-26H,7-8,11,14-16,18,34H2,1-3H3,(H,35,39)(H,36,43)(H,37,44)(H,38,42);(H,6,7)/t21-,25-,26-;/m0./s1
InChI key:GLPPXHKRTNSBBE-UBAACIDSSA-N
SMILES:CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC3=CC=CC=C3)NC(=O)[C@H](C)NC(=O)CCC(=O)OC.C(=O)(C(F)(F)F)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
MeOSuc-Ala-Phe-Lys-AMC
CAS:MeOSuc-AFK-AMC, a highly sensitive fluorogenic substrate for plasmin.Formula:C33H41N5O8Purity:95.1%Color and Shape:White LyophilisateMolecular weight:635.72L-Lysinamide, N-(4-methoxy-1,4-dioxobutyl)-L-alanyl-L-phenylalanyl-N-(4-methyl-2-oxo-2H-1-benzopyran-7-yl)-, mono(trifluoroacetate) (9CI)
CAS:Formula:C35H42F3N5O10Molecular weight:749.7307MeOSuc-Ala-Phe-Lys-AMC trifluoroacetate salt
CAS:MeOSuc-Ala-Phe-Lys-AMC is a compound that has a destabilizing effect on the vascular wall, due to its ability to inhibit proteolytic activity. It is also able to reduce the level of angiogenic factors, and thus has an anti-angiogenic effect. MeOSuc-Ala-Phe-Lys-AMC has been shown to have a macroscopic effect on vessels in tissue culture, and this can be observed through leucocyte migration. MeOSuc-Ala-Phe-Lys-AMC has also been shown to cause haemorrhagic changes in microvessels and muscle cells. This compound is also able to inhibit placental growth factor and muscle cell proliferation, as well as reducing the number of microvessels in the placenta.Formula:C33H41N5O8•C2HF3O2Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:749.73 g/mol



