CAS 20186-22-5
:(6aS,12aS)-3-methoxy-6H-[1,3]dioxolo[5,6][1]benzofuro[3,2-c]chromen-6a(12aH)-ol
Description:
The chemical substance known as "(6aS,12aS)-3-methoxy-6H-[1,3]dioxolo[5,6][1]benzofuro[3,2-c]chromen-6a(12aH)-ol," with the CAS number 20186-22-5, is a complex organic compound characterized by its unique structural features, including a chromene core fused with a benzofuro and dioxole moieties. This compound typically exhibits properties associated with flavonoids, such as antioxidant activity, which may be attributed to its polyphenolic structure. The presence of the methoxy group enhances its solubility and may influence its biological activity. Additionally, the stereochemistry indicated by the (6aS,12aS) configuration suggests specific spatial arrangements that can affect the compound's interactions with biological targets. Such compounds are often studied for their potential therapeutic applications, including anti-inflammatory and neuroprotective effects. The intricate arrangement of functional groups contributes to its reactivity and potential applications in pharmaceuticals or natural product chemistry. Overall, this substance represents a fascinating area of study within organic and medicinal chemistry.
Formula:C17H14O6
InChI:InChI=1/C17H14O6/c1-19-9-2-3-10-12(4-9)20-7-17(18)11-5-14-15(22-8-21-14)6-13(11)23-16(10)17/h2-6,16,18H,7-8H2,1H3/t16-,17+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6H-[1,3]Dioxolo[5,6]benzofuro[3,2-c][1]benzopyran-6a(12aH)-ol, 3-methoxy-, (6aS,12aS)-
CAS:Formula:C17H14O6Color and Shape:SolidMolecular weight:314.2895Pisatin
CAS:<p>Pisatin is an isoflavonoid phytoalexin synthesized by pea (Pisum sativum L.).</p>Formula:C17H14O6Purity:98%Color and Shape:SolidMolecular weight:314.29Pisatin
CAS:<p>Pisatin is a phytoalexin, which is a naturally occurring compound produced by the pea plant (Pisum sativum) as part of its defense mechanism. This compound is synthesized in response to pathogen attack, particularly fungal infections, thereby serving as an innate protective measure for the plant. Pisatin exhibits its mode of action by disrupting the membranes and metabolic pathways of invading fungal pathogens, impeding their ability to grow and proliferate.</p>Formula:C17H14O6Purity:Min. 95%Molecular weight:314.29 g/mol




