CAS 20186-29-2
:7-methoxy-2-oxo-2H-chromen-6-yl beta-D-glucopyranoside
Description:
7-Methoxy-2-oxo-2H-chromen-6-yl beta-D-glucopyranoside, with the CAS number 20186-29-2, is a glycoside compound that features a chromone backbone, which is a fused benzopyran structure. This compound is characterized by the presence of a methoxy group at the 7-position and a glucopyranoside moiety, indicating that it is a derivative of glucose. The glucopyranoside part contributes to its solubility in water and potential biological activity, as glycosides often exhibit various pharmacological properties. The 2-oxo group suggests that it may participate in various chemical reactions, including those involving nucleophiles. This compound may be of interest in medicinal chemistry due to its potential antioxidant, anti-inflammatory, or anticancer activities, which are common in flavonoid derivatives. Its structural features may also influence its interaction with biological targets, making it a candidate for further research in drug development and natural product chemistry.
Formula:C16H18O9
InChI:InChI=1/C16H18O9/c1-22-9-5-8-7(2-3-12(18)23-8)4-10(9)24-16-15(21)14(20)13(19)11(6-17)25-16/h2-5,11,13-17,19-21H,6H2,1H3/t11-,13-,14+,15-,16-/m1/s1
Synonyms:- 2H-1-Benzopyran-2-one, 6-(b-D-glucopyranosyloxy)-7-methoxy-
- 2H-1-Benzopyran-2-one, 6-(beta-D-glucopyranosyloxy)-7-methoxy-
- Magnolioside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2H-1-Benzopyran-2-one, 6-(β-D-glucopyranosyloxy)-7-methoxy-
CAS:Formula:C16H18O9Purity:98%Color and Shape:SolidMolecular weight:354.3087Magnolioside
CAS:Magnolioside has anti-plasmodial activity, shows notable growth inhibitory activity against chloroquine-sensitive strains of P.Formula:C16H18O9Purity:96.45% - 99.52%Color and Shape:SolidMolecular weight:354.31Ref: TM-TN1905
1mg84.00€5mg177.00€10mg268.00€25mg442.00€50mg645.00€100mg888.00€1mL*10mM (DMSO)178.00€Magnolioside
CAS:Magnolioside is a bioactive compound that has been shown to have potent anti-inflammatory effects. It has been shown to inhibit the production of pro-inflammatory cytokines, such as tumor necrosis factor (TNF) and interleukin-1β (IL-1β), by inhibiting the activation of nuclear factor kappa B (NFκB). Magnolioside also inhibits the production of cyclooxygenase-2 (COX-2) and reduces the production of prostaglandins. This compound also has neuroprotective effects and was found to be effective against radiation-induced cognitive impairment in rats. Magnolioside is cytotoxic to cancer cells, including colorectal cancer cell lines, and may be a potential anticancer agent for colon cancer. The mechanism by which Magnolioside exerts its cytotoxic effect on cancer cells is not well understood; however, it may involve modulation of cellular signaling pathways or inhibition ofFormula:C16H18O9Purity:Min. 95%Molecular weight:354.31 g/mol





