CAS 20188-83-4
:2-(3,4-dihydroxyphenyl)-5-hydroxy-7-methoxy-4-oxo-4H-chromen-3-yl 6-deoxy-alpha-L-mannopyranoside
Description:
The chemical substance known as "2-(3,4-dihydroxyphenyl)-5-hydroxy-7-methoxy-4-oxo-4H-chromen-3-yl 6-deoxy-alpha-L-mannopyranoside," with the CAS number 20188-83-4, is a glycoside derived from a flavonoid structure. It features a chromen-4-one core, which is characteristic of flavonoids, and is substituted with multiple hydroxyl groups that contribute to its potential antioxidant properties. The presence of the methoxy group enhances its lipophilicity, which may influence its biological activity and solubility. The attached 6-deoxy-alpha-L-mannopyranoside moiety indicates that it is a sugar derivative, which can affect its pharmacokinetics and interaction with biological systems. This compound may exhibit various biological activities, including anti-inflammatory and antioxidant effects, making it of interest in pharmacological research. Its complex structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents. However, detailed studies are necessary to fully elucidate its properties and mechanisms of action.
Formula:C22H22O11
InChI:InChI=1/C22H22O11/c1-8-16(26)18(28)19(29)22(31-8)33-21-17(27)15-13(25)6-10(30-2)7-14(15)32-20(21)9-3-4-11(23)12(24)5-9/h3-8,16,18-19,22-26,28-29H,1-2H3/t8-,16-,18+,19+,22-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Rhamnetin 3-rhamnoside
CAS:<p>Rhamnetin 3-rhamnoside is a flavonoid glycoside, which is a type of polyphenolic compound typically found in plants. It is primarily derived from natural sources such as fruits, vegetables, and certain medicinal plants, where it often contributes to the plant's natural defense mechanisms. The compound acts as a potent antioxidant due to its capability to scavenge free radicals, thereby protecting cells from oxidative stress and potential damage.</p>Formula:C22H22O11Purity:Min. 95%Molecular weight:462.4 g/mol
