CAS 20188-85-6: 5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-4-oxo-4H-chromen-3-yl 6-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranoside
Description:The chemical substance known as "5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-4-oxo-4H-chromen-3-yl 6-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranoside," with the CAS number 20188-85-6, is a glycosylated flavonoid compound. It features a chromone backbone, which is characteristic of flavonoids, and is substituted with multiple hydroxyl and methoxy groups that contribute to its potential biological activity. The presence of the glucopyranoside moiety indicates that it is a glycoside, which may enhance its solubility and bioavailability. This compound is of interest in pharmacological research due to its potential antioxidant, anti-inflammatory, and anticancer properties, often attributed to the flavonoid structure. Its complex structure suggests that it may interact with various biological targets, making it a candidate for further studies in medicinal chemistry and natural product research. The specific stereochemistry and functional groups present in this compound play a crucial role in its reactivity and biological interactions.
Formula:C29H34O16
InChI:InChI=1/C29H34O16/c1-10-19(32)22(35)24(37)28(42-10)41-9-17-20(33)23(36)25(38)29(44-17)45-27-21(34)18-14(31)7-12(39-2)8-16(18)43-26(27)11-4-5-13(30)15(6-11)40-3/h4-8,10,17,19-20,22-25,28-33,35-38H,9H2,1-3H3/t10-,17+,19-,20+,22+,23-,24+,25+,28+,29-/m0/s1
- Synonyms:
- 4H-1-Benzopyran-4-one, 3-((6-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranosyl)oxy)-5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-