CAS 20191-76-8

2,4-dibromonaphthalen-1-amine

Description:

2,4-Dibromonaphthalen-1-amine is an organic compound characterized by its structure, which consists of a naphthalene ring substituted with two bromine atoms at the 2 and 4 positions and an amino group (-NH2) at the 1 position. This compound is typically a solid at room temperature and may exhibit a range of physical properties such as color and solubility depending on its purity and the presence of other functional groups. It is known for its potential applications in organic synthesis, particularly in the development of dyes, pharmaceuticals, and agrochemicals. The presence of bromine atoms enhances its reactivity, making it useful in various chemical reactions, including electrophilic substitution. Additionally, the amino group can participate in hydrogen bonding, influencing its solubility in polar solvents. Safety precautions should be taken when handling this compound, as brominated compounds can pose environmental and health risks. Overall, 2,4-dibromonaphthalen-1-amine is a significant compound in the field of organic chemistry with diverse applications.

Formula: C₁₀H₇Br₂N

InChI: InChI=1/C10H7Br2N/c11-8-5-9(12)10(13)7-4-2-1-3-6(7)8/h1-5H,13H2

SMILES: c1ccc2c(c1)c(cc(c2N)Br)Br

Synonyms:

• 1-Amino-2,4-dibromonaphthalene

1-Amino-2,4-dibromonaphthalene

CAS: 20191-76-8

Formula: C₁₀H₇Br₂N

Purity: 98%

Color and Shape: Solid

Molecular weight: 300.9773

Ref: IN-DA00BJQY

1-Amino-2,4-dibromonaphthalene

CAS: 20191-76-8

1-Amino-2,4-dibromonaphthalene

Formula: C₁₀H₇Br₂N

Purity: 97%

Color and Shape: Solid

Molecular weight: 300.98g/mol

Ref: 54-OR310548

2,4-Dibromonaphthalen-1-amine

CAS: 20191-76-8

Formula: C₁₀H₇Br₂N

Purity: 98%

Color and Shape: Solid

Molecular weight: 300.981

Ref: 10-F517747