CAS 201940-08-1

tert-butyl 5-bromo-1,3-dihydro-2H-isoindole-2-carboxylate

Description:

Tert-butyl 5-bromo-1,3-dihydro-2H-isoindole-2-carboxylate is a chemical compound characterized by its unique structure, which includes a tert-butyl ester group and a brominated isoindole framework. This compound typically exhibits moderate solubility in organic solvents, such as dichloromethane and ethyl acetate, while being less soluble in water due to its hydrophobic tert-butyl group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical transformations, including nucleophilic substitutions and coupling reactions. The isoindole moiety contributes to its aromatic character, which can influence its electronic properties and reactivity. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its synthesis often involves multi-step organic reactions, highlighting its complexity and the need for careful handling in laboratory settings. Overall, tert-butyl 5-bromo-1,3-dihydro-2H-isoindole-2-carboxylate serves as a valuable building block in organic synthesis and pharmaceutical research.

Formula: C₁₃H₁₆BrNO₂

InChI: InChI=1/C13H16BrNO2/c1-13(2,3)17-12(16)15-7-9-4-5-11(14)6-10(9)8-15/h4-6H,7-8H2,1-3H3

SMILES: CC(C)(C)OC(=O)N1Cc2ccc(cc2C1)Br

Synonyms:

• Tert-Butyl 5-Bromoisoindoline-2-Carboxylate

2H-Isoindole-2-carboxylic acid, 5-bromo-1,3-dihydro-, 1,1-dimethylethyl ester

CAS: 201940-08-1

Formula: C₁₃H₁₆BrNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 298.1756

Ref: IN-DA0027WW

tert-Butyl 5-bromoisoindoline-2-carboxylate

CAS: 201940-08-1

tert-Butyl 5-bromoisoindoline-2-carboxylate

Purity: 98%

Color and Shape: White Solid

Molecular weight: 298.18g/mol

Ref: 54-OR302276

N-Boc-5-Bromoisoindoline

CAS: 201940-08-1

Formula: C₁₃H₁₆BrNO₂

Purity: 95%

Color and Shape: Solid, White powder

Molecular weight: 298.18

Ref: 10-F050179