CAS 20197-87-9: 2,6-Dichloroquinazolin-4(3H)-one

Description:2,6-Dichloroquinazolin-4(3H)-one is a heterocyclic compound characterized by its quinazolinone structure, which features a fused benzene and pyrimidine ring system. This compound is notable for the presence of two chlorine atoms at the 2 and 6 positions of the quinazoline ring, which can influence its reactivity and biological activity. It typically appears as a crystalline solid and is soluble in organic solvents. The compound is of interest in medicinal chemistry due to its potential pharmacological properties, including antimicrobial and anticancer activities. Its molecular structure allows for various chemical modifications, which can enhance its efficacy or selectivity in biological applications. Additionally, the presence of the carbonyl group in the 4-position contributes to its reactivity, making it a useful intermediate in organic synthesis. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns.

Formula:C₈H₄Cl₂N₂O

InChI:InChI=1S/C8H4Cl2N2O/c9-4-1-2-6-5(3-4)7(13)12-8(10)11-6/h1-3H,(H,11,12,13)

Found 4 products.

Product data	Purity	Price range	Estimated delivery
4(3H)-Quinazolinone, 2,6-dichloro- REF: IN-DA0027YSCAS: 20197-87-9	98%	To inquire	Wed 26 Mar 25
2,6-Dichloroquinazolin-4(3H)-one REF: 10-F093064CAS: 20197-87-9	95.0%	95.00 €~962.00 €	Mon 31 Mar 25
2,6-Dichloroquinazolin-4(3H)-one REF: 54-OR471282CAS: 20197-87-9	- - -	To inquire	Wed 02 Apr 25
2,6-Dichloroquinazolin-4(3H)-one REF: 3D-FD42055CAS: 20197-87-9	Min. 95%	- - -	Discontinued product