CAS 20198-19-0
:2-Amino-4(1H)-quinazolinone
Description:
2-Amino-4(1H)-quinazolinone, with the CAS number 20198-19-0, is a heterocyclic organic compound characterized by a quinazolinone structure, which consists of a fused benzene and pyrimidine ring system. This compound features an amino group at the 2-position and a carbonyl group at the 4-position of the quinazolinone ring, contributing to its reactivity and potential biological activity. It is typically a crystalline solid, exhibiting moderate solubility in polar solvents. The presence of the amino group allows for hydrogen bonding, which can influence its interactions in biological systems. 2-Amino-4(1H)-quinazolinone has garnered interest in medicinal chemistry due to its potential pharmacological properties, including antimicrobial and anticancer activities. Its derivatives are also studied for various applications in drug development. As with many heterocycles, the compound's properties can be influenced by substituents and the overall molecular environment, making it a subject of interest in both synthetic and medicinal chemistry research.
Formula:C8H7N3O
InChI:InChI=1/C8H7N3O/c9-8-10-6-4-2-1-3-5(6)7(12)11-8/h1-4H,(H3,9,10,11,12)
InChI key:InChIKey=SDTFBAXSPXZDKC-UHFFFAOYSA-N
SMILES:O=C1C=2C(NC(N)=N1)=CC=CC2
Synonyms:- 2-Amino-1H-quinazolin-4-one
- 2-Amino-3,4-dihydroquinazolin-4-one
- 2-Amino-3H-quinazolin-4-one
- 2-Amino-4(1H)-quinazolinone
- 2-Amino-4(3H)-quinazolinone
- 2-Amino-4-hydroxyquinazoline
- 2-Amino-4-quinazolinone
- 2-Amino-4-quinazolone
- 2-Aminoquinazolin-4(3H)-one
- 2-Aminoquinazolin-4-ol
- 4(1H)-Quinazolinone, 2,3-dihydro-2-imino-
- 4(1H)-Quinazolinone, 2-amino-
- 4(3H)-quinazolinone, 2-amino-
- 4-Quinazolinol, 2-amino-
- 5,8-Dideazapterin
- NSC 174024
- NSC 51782
- 2-Aminoquinazolone-4
- N-[(diphenylmethylene)amino]-N-(phenylmethyl)aniline
- 2-amino-1,4-dihydroquinazolin-4-one
- 2-aminoquinazolin-4(1H)-one
- AKOS AUF2038
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4(1H)-Quinazolinone, 2-amino-
CAS:Formula:C8H7N3OPurity:97%Color and Shape:SolidMolecular weight:161.16072-Aminoquinazolin-4-ol
CAS:2-Aminoquinazolin-4-olPurity:≥95%Color and Shape:SolidMolecular weight:161.16g/mol2-Aminoquinazolin-4(3H)-one
CAS:Formula:C8H7N3OPurity:97%Color and Shape:SolidMolecular weight:161.1642-Amino-3h-quinazolin-4-one
CAS:2-Amino-3h-quinazolin-4-one (2AQ) is a molecule that has been synthesized to inhibit the synthesis of thymidylate, which is an important biochemical in the process of DNA replication. This chemical has been shown to have properties similar to rapamycin, which is an immunosuppressant drug used in transplant patients and people with autoimmune diseases. 2AQ can also be used as a light emitting molecule for biological research. It does not have any effect on mammalian cells, but it does inhibit tumor cell growth in vitro. The mechanism of 2AQ's antitumor activity may be due to its ability to regulate transcriptional regulation and energy efficiency.Formula:C8H7N3OPurity:Min. 95%Molecular weight:161.16 g/mol



