CymitQuimica logo

CAS 201990-24-1

:

{[(3R)-1,1-dioxido-2,3-dihydrothiophen-3-yl]ammonio}acetate

Description:
The chemical substance known as {(3R)-1,1-dioxido-2,3-dihydrothiophen-3-yl]ammonio}acetate, with the CAS number 201990-24-1, is characterized by its unique structural features and functional groups. It contains a thiophene ring, which is a five-membered aromatic ring containing sulfur, and is modified with a dioxido group, indicating the presence of two oxygen atoms bonded to the sulfur atom. The compound also features an ammonium group, suggesting it has basic properties and can participate in ionic interactions. The acetate portion of the molecule indicates that it can act as a salt, contributing to its solubility in polar solvents. This compound may exhibit interesting chemical reactivity due to the presence of both the thiophene and ammonium functionalities, making it potentially useful in various applications, including organic synthesis and materials science. Its stereochemistry, indicated by the (3R) designation, suggests specific spatial arrangements that could influence its biological activity and interactions with other molecules.
Formula:C6H9NO4S
InChI:InChI=1/C6H9NO4S/c8-6(9)3-7-5-1-2-12(10,11)4-5/h1-2,5,7H,3-4H2,(H,8,9)/t5-/m1/s1
SMILES:C1=CS(=O)(=O)C[C@@H]1NCC(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.