CAS 201992-89-4
:4-(Adamantan-1-yl)-5-methyl-1,3-thiazol-2-amine
Description:
4-(Adamantan-1-yl)-5-methyl-1,3-thiazol-2-amine is a chemical compound characterized by its unique structure, which includes an adamantane moiety and a thiazole ring. The presence of the adamantane group contributes to its rigidity and hydrophobic properties, while the thiazole ring introduces heteroatoms (nitrogen and sulfur) that can participate in various chemical interactions. This compound is typically classified as an amine due to the presence of the amino group (-NH2) attached to the thiazole ring. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with thiazole derivatives. The compound may exhibit properties such as antimicrobial or anticancer activity, although specific biological data would be necessary to confirm these effects. Additionally, its solubility, stability, and reactivity can be influenced by the functional groups present, making it a subject of interest for further research in organic synthesis and drug design.
Formula:C14H20N2S
InChI:InChI=1/C14H20N2S/c1-8-12(16-13(15)17-8)14-5-9-2-10(6-14)4-11(3-9)7-14/h9-11H,2-7H2,1H3,(H2,15,16)
SMILES:Cc1c(C23CC4CC(CC(C4)C3)C2)[nH]c(=N)s1
Synonyms:- 2-Thiazolamine, 5-Methyl-4-Tricyclo[3.3.1.1~3,7~]Dec-1-Yl-
- 5-Methyl-4-Tricyclo[3.3.1.1~3,7~]Dec-1-Yl-1,3-Thiazol-2-Amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
