CymitQuimica logo

CAS 201996-37-4

:

1,3,5-triazine-2,4,6-triol

Description:
1,3,5-Triazine-2,4,6-triol, also known as cyanuric acid, is a heterocyclic compound characterized by a six-membered ring containing three nitrogen atoms and three carbon atoms, with hydroxyl groups (-OH) attached to each carbon. This compound is typically white, crystalline, and water-soluble, exhibiting a high degree of stability under normal conditions. Its structure allows for the formation of hydrogen bonds, contributing to its solubility and reactivity. 1,3,5-Triazine-2,4,6-triol is commonly used in various applications, including as a stabilizer for chlorine in swimming pools, in the production of herbicides, and as a precursor in the synthesis of other chemical compounds. Additionally, it has potential uses in the field of materials science and as a building block in organic synthesis. The compound's properties, such as its ability to form complexes with metals and its role in chemical reactions, make it a subject of interest in both industrial and research settings.
Formula:C3H3N3O3
InChI:InChI=1/C3H3N3O3/c7-1-4-2(8)6-3(9)5-1/h(H3,4,5,6,7,8,9)/i1+1,2+1,3+1
InChI key:ZFSLODLOARCGLH-VMIGTVKRSA-N
SMILES:[13C]1(=O)N[13C](=O)N[13C](=O)N1
Found 7 products.