CymitQuimica logo

CAS 20201-26-7

:

Ethyl 4-bromobenzoylformate

Description:
Ethyl 4-bromobenzoylformate, with the CAS number 20201-26-7, is an organic compound characterized by its ester functional group and the presence of a bromine atom on the aromatic ring. This compound typically appears as a colorless to pale yellow liquid and is known for its moderate solubility in organic solvents. Its molecular structure features an ethyl group attached to a 4-bromobenzoyl moiety, which contributes to its reactivity and potential applications in organic synthesis. Ethyl 4-bromobenzoylformate can participate in various chemical reactions, including acylation and esterification, making it useful in the synthesis of more complex organic molecules. Additionally, the bromine substituent can enhance the electrophilicity of the aromatic ring, facilitating further chemical transformations. Safety data indicates that, like many brominated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, this compound serves as a valuable intermediate in the field of organic chemistry and pharmaceuticals.
Formula:C10H9BrO3
InChI:InChI=1/C10H9BrO3/c1-2-14-10(13)9(12)7-3-5-8(11)6-4-7/h3-6H,2H2,1H3
InChI key:SFOMTBBEDGCTHQ-UHFFFAOYSA-N
SMILES:CCOC(=O)C(=O)c1ccc(cc1)Br
Synonyms:
  • Ethyl 2-(4-bromophenyl)-2-oxoacetate
  • Ethyl (4-bromophenyl)glyoxylate
  • Ethyl p-bromophenylglyoxylate
  • Ethyl (4-Bromophenyl)(Oxo)Acetate
Found 4 products.