CAS 20204-80-2

[(1R,2S,4R,5R)-3-hydroxy-4-(p-tolylsulfonyloxy)-6,8-dioxabicyclo[3.2.1]octan-2-yl] 4-methylbenzenesulfonate

Description:

The chemical substance with the name "[(1R,2S,4R,5R)-3-hydroxy-4-(p-tolylsulfonyloxy)-6,8-dioxabicyclo[3.2.1]octan-2-yl] 4-methylbenzenesulfonate" and CAS number 20204-80-2 is a complex organic compound characterized by its bicyclic structure and the presence of multiple functional groups. It features a bicyclo[3.2.1]octane framework, which contributes to its unique stereochemistry, indicated by the specific R and S configurations at various chiral centers. The compound contains a hydroxyl group (-OH) and a sulfonyloxy group, which enhances its reactivity and solubility in polar solvents. The presence of the p-tolylsulfonyloxy moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to participate in various chemical reactions. Additionally, the sulfonate group may improve the compound's bioavailability and stability. Overall, this compound exemplifies the intricate design often found in synthetic organic chemistry, with implications for both research and practical applications in drug development.

Formula: C₂₀H₂₂O₉S₂

InChI: InChI=1/C20H22O9S2/c1-12-3-7-14(8-4-12)30(22,23)28-18-16-11-26-20(27-16)19(17(18)21)29-31(24,25)15-9-5-13(2)6-10-15/h3-10,16-21H,11H2,1-2H3/t16-,17?,18-,19-,20-/m1/s1

SMILES: Cc1ccc(cc1)S(=O)(=O)O[C@@H]1[C@H]2CO[C@@H]([C@@H](C1O)OS(=O)(=O)c1ccc(C)cc1)O2

β-D-Glucopyranose, 1,6-anhydro-, 2,4-bis(4-methylbenzenesulfonate)

CAS: 20204-80-2

Formula: C₂₀H₂₂O₉S₂

Color and Shape: Solid

Molecular weight: 470.5133

Ref: IN-DA00280P

1,6-Anhydro-2,4-di-O-p-toluenesulfonyl-b-D-glucopyranose

CAS: 20204-80-2

Ref: 7W-GC4987

1,6-Anhydro-2,4-di-O-p-toluenesulfonyl-β-D-glucopyranose

CAS: 20204-80-2

1,6-Anhydro-2,4-di-O-p-toluenesulfonyl-b-D-glucopyranose is a fluorinated sugar that is synthesized by the reaction of 1,6 anhydro-2,4 di O p toluenesulfonyl b D glucopyranose and osmium tetroxide. The synthesis of this compound involves the use of high purity reagents and solvents. This product can be custom synthesized to order with a minimum quantity of 500 grams.

Formula: C₂₀H₂₂O₉S₂

Purity: Min. 95%

Molecular weight: 470.52 g/mol

Ref: 3D-MA04605