CymitQuimica logo

CAS 2021-40-1

:

(4-hydroxy-3-methoxyphenyl)(oxo)acetic acid

Description:
(4-hydroxy-3-methoxyphenyl)(oxo)acetic acid, also known by its CAS number 2021-40-1, is an organic compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) and a methoxy group (-OCH3) attached to a benzene ring. This compound features an oxoacetic acid moiety, indicating the presence of a carbonyl group (C=O) adjacent to a carboxylic acid (-COOH) functional group. The presence of these functional groups contributes to its acidic properties and potential reactivity in various chemical reactions. It is soluble in polar solvents due to its ability to form hydrogen bonds, and its phenolic nature may impart antioxidant properties. This compound may be of interest in pharmaceutical and biochemical research due to its potential biological activities, including anti-inflammatory and antioxidant effects. Additionally, its structural characteristics suggest it could serve as a precursor or intermediate in the synthesis of more complex organic molecules.
Formula:C9H8O5
InChI:InChI=1/C9H8O5/c1-14-7-4-5(2-3-6(7)10)8(11)9(12)13/h2-4,10H,1H3,(H,12,13)
SMILES:COc1cc(ccc1O)C(=O)C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.