CAS 2021-62-7: β-D-Galactopyranosyl fluoride

Description:β-D-Galactopyranosyl fluoride is a chemical compound characterized by its structure as a galactose derivative, specifically a pyranosyl form where a fluoride group is substituted at the anomeric carbon. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and methanol, owing to its hydroxyl groups. It is often used in biochemical research, particularly in studies involving glycosylation reactions and carbohydrate chemistry, due to its ability to act as a glycosyl donor. The presence of the fluoride group can enhance its reactivity in various chemical transformations. Additionally, β-D-Galactopyranosyl fluoride can participate in enzymatic reactions, making it a valuable tool in the synthesis of glycosides and oligosaccharides. Safety data indicates that, like many fluorinated compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, its unique structural features and reactivity make it an important compound in the field of carbohydrate chemistry.

Formula:C₆H₁₁FO₅

InChI:InChI=1S/C6H11FO5/c7-6-5(11)4(10)3(9)2(1-8)12-6/h2-6,8-11H,1H2/t2-,3+,4+,5-,6-/m1/s1

InChI key:InChIKey=ATMYEINZLWEOQU-FPRJBGLDSA-N

SMILES:FC1OC(CO)C(O)C(O)C1O