CAS 20227-41-2
:9-(2-Deoxy-2-fluoro-beta-D-arabinofuranosyl)adenine
Description:
9-(2-Deoxy-2-fluoro-beta-D-arabinofuranosyl)adenine, commonly referred to as 2-fluoro-arabinofuranosyl adenine, is a nucleoside analog characterized by the presence of a fluorine atom at the 2' position of the deoxyribose sugar moiety. This modification enhances its stability and bioactivity compared to its natural counterparts. The compound features an adenine base linked to a sugar moiety, which is crucial for its role in nucleic acid synthesis and function. It exhibits antiviral properties, particularly against certain viruses, by interfering with viral replication processes. The presence of the fluorine atom can also influence the compound's interaction with enzymes involved in nucleic acid metabolism. As a research chemical, it is often studied for its potential therapeutic applications in virology and oncology. Its CAS number, 20227-41-2, is a unique identifier that facilitates its identification in chemical databases and literature. Overall, this compound represents a significant area of interest in medicinal chemistry and drug development.
Formula:C10H12FN5O3
InChI:InChI=1/C10H12FN5O3/c11-5-7(18)4(1-17)19-10(5)16-3-15-6-8(12)13-2-14-9(6)16/h2-5,7,10,17-18H,1H2,(H2,12,13,14)/t4-,5+,7-,10-/m1/s1
Synonyms:- 9-(2-Deoxy-2-fluoro-beta-D-arabinofuranosyl)-9H-purin-6-amine
- 6-Amino-purine-2'-fluoro-2'-deoxy arabineoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
9-(2-deoxy-2-fluoro-β-d-arabinofuranosyl)adenine
CAS:Formula:C10H12FN5O3Purity:98%Color and Shape:SolidMolecular weight:269.23242'-Deoxy-2'-fluoroarabinoadenosine
CAS:2'-Deoxy-2'-fluoroarabinoadenosinePurity:≥98%Molecular weight:269.23g/mol2'-Deoxy-2'-fluoroarabinoadenosine
CAS:2'-Deoxy-2'-fluoroarabinoadenosine is a nucleoside analogue with extensive anti-tumor activity and can be used for the study of tumor diseases.Formula:C10H12FN5O3Purity:99.95%Color and Shape:SolidMolecular weight:269.239-(2'-Deoxy-2'-fluoro-β-D-arabinofuranosyl)adenine
CAS:9-(2'-Deoxy-2'-fluoro-b-D-arabinofuranosyl)adenine (9dFdA) is a potent inhibitor of the enzyme s-adenosylhomocysteine hydrolase, which is involved in the synthesis of adenosine. 9dFdA inhibits the growth of Trichomonas vaginalis and has shown good activity against other pathogens, such as Staphylococcus aureus and Mycobacterium tuberculosis. It also has been shown to have potent inhibitory activity against adenosine deaminase, which prevents an immune response by preventing cells from producing the amino acid adenosine. This compound also inhibits uridine phosphorylase, which is involved in nucleotide biosynthesis.Formula:C10H12FN5O3Purity:Min. 95%Color and Shape:PowderMolecular weight:269.24 g/mol(2R,3R,4S,5R)-5-(6-Amino-9H-purin-9-yl)-4-fluoro-2-(hydroxymethyl)tetrahydrofuran-3-ol
CAS:Purity:98%Molecular weight:269.2359924






