CAS 202272-68-2

N~4~-(1-benzyl-1H-indazol-5-yl)-N~6~,N~6~-dimethylpyrido[3,4-d]pyrimidine-4,6-diamine

Description:

N~4~-(1-benzyl-1H-indazol-5-yl)-N~6~,N~6~-dimethylpyrido[3,4-d]pyrimidine-4,6-diamine is a synthetic organic compound characterized by its complex structure, which includes multiple aromatic and heterocyclic rings. This compound features a pyrido[3,4-d]pyrimidine core, which is known for its potential biological activity, particularly in medicinal chemistry. The presence of the benzyl and indazole moieties suggests that it may exhibit interesting pharmacological properties, possibly acting as a kinase inhibitor or having other therapeutic applications. The dimethyl substitution on the pyrimidine ring can influence its solubility and reactivity, making it a subject of interest in drug design. Additionally, the compound's molecular weight, solubility in various solvents, and stability under different conditions would be essential for understanding its behavior in biological systems. Overall, this compound represents a class of molecules that may have significant implications in drug discovery and development, particularly in targeting specific biological pathways.

Formula: C₂₃H₂₁N₇

InChI: InChI=1/C23H21N7/c1-29(2)22-11-19-20(13-24-22)25-15-26-23(19)28-18-8-9-21-17(10-18)12-27-30(21)14-16-6-4-3-5-7-16/h3-13,15H,14H2,1-2H3,(H,25,26,28)

SMILES: CN(C)c1cc2c(cn1)ncnc2Nc1ccc2c(c1)cnn2Cc1ccccc1

Synonyms:

• pyrido[3,4-d]pyrimidine-4,6-diamine, N~6~,N~6~-dimethyl-N~4~-[1-(phenylmethyl)-1H-indazol-5-yl]-

GW2974

CAS: 202272-68-2

Formula: C₂₃H₂₁N₇

Purity: ≥ 98.0%

Color and Shape: Yellow powder

Molecular weight: 395.46

Ref: 7W-GK5960

GW2974

CAS: 202272-68-2

GW2974, Oral EGFR/ErbB2 dual inhibitor, inhibits glioblastoma multiforme (GBM) cell invasion and tumor growth.

Formula: C₂₃H₂₁N₇

Molecular weight: 395.46

Ref: TM-T24119