CAS 20231-01-0

1,1′-(Dithiodicarbonothioyl)bis[4-methylpiperazine]

Description:

1,1′-(Dithiodicarbonothioyl)bis[4-methylpiperazine] is a chemical compound characterized by its unique structure, which includes two 4-methylpiperazine moieties linked by a dithiodicarbonothioyl group. This compound features sulfur atoms in its structure, indicating potential reactivity associated with thiol groups. It is typically used in organic synthesis and may serve as a cross-linking agent or a building block in the development of polymers and other materials. The presence of the piperazine rings suggests that it may exhibit properties such as basicity and the ability to form hydrogen bonds, which can influence its solubility and interaction with other chemical species. Additionally, the compound may have applications in medicinal chemistry due to the biological activity often associated with piperazine derivatives. Safety data should be consulted for handling and storage, as compounds containing sulfur and nitrogen can have specific hazards. Overall, this compound's unique structural features contribute to its potential utility in various chemical applications.

Formula: C₁₂H₂₂N₄S₄

InChI: InChI=1S/C12H22N4S4/c1-13-3-7-15(8-4-13)11(17)19-20-12(18)16-9-5-14(2)6-10-16/h3-10H2,1-2H3

InChI key: InChIKey=OOBDBFPYJXJEHC-UHFFFAOYSA-N

SMILES: C(SSC(=S)N1CCN(C)CC1)(=S)N2CCN(C)CC2

Synonyms:

• Piperazine, 1,1′-(dithiodicarbonothioyl)bis[4-methyl-
• Vulcasafe MPT
• Disulfide, bis[(4-methyl-1-piperazinyl)thiocarbonyl]
• EWP 815
• 1,1′-(Dithiodicarbonothioyl)bis[4-methylpiperazine]

EWP 815

CAS: 20231-01-0

EWP 815

Purity: ≥95%

Molecular weight: 350.59g/mol

Ref: 54-BUP10431

EWP 815

CAS: 20231-01-0

EWP 815, a disulfiram analog, inhibits Ins(1,4)P2, Ins(1,4,5)P3 phosphatases, and dopamine β-hydroxylase.

Formula: C₁₂H₂₂N₄S₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 350.59

Ref: TM-T61214