CAS 202325-51-7

Phen-2,3,4,6-d4-ol, 5-(methyl-d3)-

Description:

Phen-2,3,4,6-d4-ol, 5-(methyl-d3)- is a deuterated phenolic compound, which means it contains deuterium, a stable isotope of hydrogen, replacing some of the hydrogen atoms in its molecular structure. This compound is characterized by its aromatic ring, which contributes to its chemical stability and reactivity. The presence of hydroxyl (-OH) groups indicates its classification as a phenol, which typically exhibits properties such as acidity and the ability to form hydrogen bonds. The deuterated methyl group (methyl-d3) suggests that it has been modified for specific applications, such as in NMR spectroscopy, where deuteration can enhance signal clarity and reduce background noise. This compound may be utilized in various fields, including organic synthesis, pharmaceuticals, and analytical chemistry, particularly in studies involving isotopic labeling. Its unique isotopic composition allows for tracking and tracing in biochemical pathways or reactions, making it a valuable tool in research and development.

Formula: C₇HD₇O

InChI: InChI=1S/C7H8O/c1-6-3-2-4-7(8)5-6/h2-5,8H,1H3/i1D3,2D,3D,4D,5D

InChI key: InChIKey=RLSSMJSEOOYNOY-AAYPNNLASA-N

SMILES: C(C1=C(C(O)=C(C(=C1[2H])[2H])[2H])[2H])([2H])([2H])[2H]

Synonyms:

• Phen-2,3,4,6-d4-ol, 5-(methyl-d3)-
• M-CRESOL-D7

m-Cresol-d7

CAS: 202325-51-7

Formula: CD₃C₆D₄OH

Purity: 98 atom % D

Color and Shape: Colorless-Pale Yellow Liquid.

Molecular weight: 115.10145

Ref: 3U-D5637

m-Cresol-d7

Controlled Product

CAS: 202325-51-7

Applications sotope labelled m-Cresol (C781915) is one of the components that make up liquid rice hull smoke, and may contribute to its anti-inflammatory effects in mice.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package

Formula: C₇D₇HO

Color and Shape: Neat

Molecular weight: 115.18

Ref: TR-C781917