CAS 20235-78-3: 1-beta-D-ribofuranosyl-2-thioxo-2,3-dihydropyrimidin-4(1H)-one
Description:1-beta-D-ribofuranosyl-2-thioxo-2,3-dihydropyrimidin-4(1H)-one, with the CAS number 20235-78-3, is a nucleoside analog characterized by its unique structural features. This compound consists of a ribofuranosyl sugar moiety linked to a thioxo-dihydropyrimidinone base, which contributes to its potential biological activity. The thioxo group enhances its reactivity and may influence its interaction with biological targets, such as enzymes or nucleic acids. The presence of the ribofuranosyl unit suggests that it may mimic natural nucleosides, potentially allowing it to participate in biochemical processes. This compound has garnered interest in medicinal chemistry for its potential antiviral or anticancer properties, as modifications to nucleosides often lead to enhanced therapeutic effects. Its solubility, stability, and reactivity can vary based on environmental conditions, making it a subject of study in drug development and biochemical research. Overall, 1-beta-D-ribofuranosyl-2-thioxo-2,3-dihydropyrimidin-4(1H)-one represents a significant area of exploration in the field of nucleoside chemistry.
Formula:C9H12N2O5S
InChI:InChI=1/C9H12N2O5S/c12-3-4-6(14)7(15)8(16-4)11-2-1-5(13)10-9(11)17/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,17)/t4-,6-,7-,8-/m1/s1
