CymitQuimica logo

CAS 202350-68-3

:

PNU159682

Description:
PNU159682, with the CAS number 202350-68-3, is a chemical compound that has been studied primarily for its potential therapeutic applications. It is known to act as a selective antagonist of certain receptors, particularly in the context of neurological research. The compound exhibits properties that may influence neurotransmitter systems, making it of interest in the study of various neurological disorders. Its molecular structure includes specific functional groups that contribute to its biological activity and selectivity. PNU159682 has been evaluated in preclinical studies, where it demonstrated effects that could be beneficial in modulating synaptic transmission and neuronal excitability. However, detailed pharmacokinetic and toxicological profiles are essential for understanding its safety and efficacy in potential therapeutic contexts. As with many research compounds, further studies are necessary to fully elucidate its mechanisms of action and potential clinical applications.
Formula:C32H35NO13
InChI:InChI=1S/C32H35NO13/c1-13-29-16(33-7-8-43-31(42-3)30(33)46-29)9-20(44-13)45-18-11-32(40,19(35)12-34)10-15-22(18)28(39)24-23(26(15)37)25(36)14-5-4-6-17(41-2)21(14)27(24)38/h4-6,13,16,18,20,29-31,34,37,39-40H,7-12H2,1-3H3/t13-,16-,18-,20-,29+,30+,31-,32-/m0/s1
InChI key:SLURUCSFDHKXFR-WWMWMSKMSA-N
SMILES:C[C@H]1[C@@H]2[C@H](C[C@@H](O1)O[C@H]3C[C@@](CC4=C3C(=C5C(=C4O)C(=O)C6=C(C5=O)C(=CC=C6)OC)O)(C(=O)CO)O)N7CCO[C@@H]([C@H]7O2)OC
Found 6 products.