CymitQuimica logo

CAS 202408-30-8

:

4-Thiazoleacetic acid, 2-(acetylamino)-

Description:
4-Thiazoleacetic acid, 2-(acetylamino)- is an organic compound characterized by the presence of a thiazole ring, an acetic acid moiety, and an acetylamino group. This compound typically exhibits properties associated with both acidic and amine functionalities, making it a potential candidate for various chemical reactions and applications. The thiazole ring contributes to its heterocyclic nature, which can influence its reactivity and biological activity. The acetylamino group enhances its solubility in polar solvents and may also play a role in its interaction with biological targets. This compound is of interest in medicinal chemistry and may be explored for its potential therapeutic applications, particularly in the development of pharmaceuticals. Its molecular structure suggests that it could participate in hydrogen bonding and other intermolecular interactions, which are crucial for its biological efficacy. As with many thiazole derivatives, it may exhibit antimicrobial or anti-inflammatory properties, although specific biological activities would require further investigation.
Formula:C7H8N2O3S
InChI:InChI=1S/C7H8N2O3S/c1-4(10)8-7-9-5(3-13-7)2-6(11)12/h3H,2H2,1H3,(H,11,12)(H,8,9,10)
InChI key:KCOJFJKNUZUGHX-UHFFFAOYSA-N
SMILES:CC(=O)NC1=NC(=CS1)CC(=O)O
Found 4 products.