
CAS 202411-63-0
:Dimethoxymethylphenylsilane homopolymer
Description:
Dimethoxymethylphenylsilane homopolymer is a silane-based polymer characterized by its unique structure, which includes dimethoxy and methylphenyl functional groups. This polymer typically exhibits excellent thermal stability, chemical resistance, and adhesion properties, making it suitable for various applications in coatings, sealants, and adhesives. The presence of methoxy groups allows for potential cross-linking and curing reactions, enhancing the material's mechanical strength and durability. Additionally, the phenyl groups contribute to the polymer's hydrophobicity and UV resistance, which can be advantageous in outdoor applications. The homopolymer nature indicates that it is composed of repeating units of the same monomer, leading to a consistent performance profile. Overall, dimethoxymethylphenylsilane homopolymer is valued in industries requiring robust materials that can withstand harsh environmental conditions while maintaining structural integrity.
Formula:(C9H14O2Si)x
InChI:InChI=1S/C9H14O2Si/c1-10-12(3,11-2)9-7-5-4-6-8-9/h4-8H,1-3H3
InChI key:InChIKey=CVQVSVBUMVSJES-UHFFFAOYSA-N
SMILES:[Si](OC)(OC)(C)C1=CC=CC=C1
Synonyms:- Methylphenyldimethoxysilane homopolymer
- Benzene, (dimethoxymethylsilyl)-, homopolymer
- Silane, dimethoxymethylphenyl-, homopolymer
- Dimethoxymethylphenylsilane homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
