CymitQuimica logo

CAS 20244-21-7

:

1,2-Benzenediol, sodium salt (1:?)

Description:
1,2-Benzenediol, sodium salt, also known as sodium catechol, is a chemical compound characterized by its aromatic structure featuring two hydroxyl groups attached to a benzene ring. This compound is typically a white to off-white solid that is soluble in water due to the presence of the sodium ion, which enhances its solubility compared to its neutral form. It exhibits properties typical of phenolic compounds, including antioxidant activity and potential applications in various fields such as pharmaceuticals, cosmetics, and agriculture. The sodium salt form allows for easier handling and incorporation into formulations. Additionally, it may participate in redox reactions due to the presence of hydroxyl groups, making it useful in various chemical syntheses and as a reagent in analytical chemistry. Safety data indicates that, while it may pose some hazards, it is generally considered to have low toxicity. Proper handling and storage conditions should be observed to ensure safety and stability.
Formula:C6H6O2·xNa
InChI:InChI=1S/C6H6O2.Na/c7-5-3-1-2-4-6(5)8;/h1-4,7-8H;
InChI key:InChIKey=OQMUXQPCUBYTEB-UHFFFAOYSA-N
SMILES:OC1=C(O)C=CC=C1.[Na]
Synonyms:
  • 1,2-Benzenediol, sodium salt
  • 1,2-Benzenediol, sodium salt (1:?)
  • Pyrocatechol, sodium salt
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.