CAS 20244-86-4: 7-Methylguanosine
Description:7-Methylguanosine is a modified nucleoside that plays a crucial role in various biological processes, particularly in RNA metabolism. It is characterized by the presence of a methyl group at the nitrogen-7 position of the guanine base, which distinguishes it from standard guanosine. This modification is significant in the context of RNA stability and function, as it is involved in the capping of messenger RNA (mRNA) molecules, thereby protecting them from degradation and facilitating their translation. The chemical formula of 7-Methylguanosine reflects its composition of carbon, hydrogen, nitrogen, and oxygen atoms, typical of nucleosides. Its structure includes a ribose sugar linked to the modified guanine base. 7-Methylguanosine is found in various types of RNA, including mRNA and certain small RNAs, and is essential for proper gene expression regulation. Additionally, it has implications in research and therapeutic applications, particularly in understanding RNA processing and the development of RNA-based drugs.
Formula:C11H16N5O5
InChI:InChI=1S/C11H15N5O5/c1-15-3-16(8-5(15)9(20)14-11(12)13-8)10-7(19)6(18)4(2-17)21-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2-,12,13,14,20)/p+1/t4-,6-,7-,10-/m1/s1
InChI key:InChIKey=OGHAROSJZRTIOK-KQYNXXCUSA-O
SMILES:O=C1N=C(N)NC2=C1[N+](=CN2C3OC(CO)C(O)C3O)C
- Synonyms:
- 1H-Purinium, 2-amino-6,9-dihydro-7-methyl-6-oxo-9-beta-D-ribofuranosyl-
- 1H-Purinium, 2-amino-6,9-dihydro-7-methyl-6-oxo-9-β-<span class="text-smallcaps">D</span>-ribofuranosyl-
- 2-Amino-6,9-dihydro-7-methyl-6-oxo-9-beta-D-ribofuranosyl-1H-purinium
- 2-amino-7-methyl-9-beta-D-ribofuranosyl-7H-purin-9-ium-6-olate
- Guanosine, 7-methyl-
- N<sup>7</sup>-Methylguanosine
- Purinium, 2-amino-1,6-dihydro-7-methyl-6-oxo-9-β-<span class="text-smallcaps">D</span>-ribofuranosyl-
- Purinium, 2-amino-1,6-dihydro-7-methyl-6-oxo-9-β-D-ribofuranosyl-
- 1H-Purinium, 2-amino-6,9-dihydro-7-methyl-6-oxo-9-β-D-ribofuranosyl-
- 7-Methylguanosine
- See more synonyms
- N7-Methylguanosine
