CAS 20246-26-8
:(2S,3R)-2,3,4-Trihydroxybutanoic acid
Description:
(2S,3R)-2,3,4-Trihydroxybutanoic acid, also known as L-threonic acid, is a naturally occurring sugar acid characterized by its three hydroxyl (-OH) groups and a carboxylic acid (-COOH) functional group. This compound is a stereoisomer of threonic acid, specifically exhibiting the (2S,3R) configuration, which contributes to its unique biochemical properties. It is a white, crystalline solid that is soluble in water, making it readily available for various biological and chemical applications. L-threonic acid is involved in metabolic processes and is known for its potential health benefits, including antioxidant properties and its role in vitamin C metabolism. Its structure allows it to participate in various chemical reactions, including esterification and oxidation. Additionally, it has been studied for its potential use in food and pharmaceutical industries due to its safety and functional properties. Overall, (2S,3R)-2,3,4-Trihydroxybutanoic acid is a significant compound in both organic chemistry and biochemistry.
Formula:C4H8O5
InChI:InChI=1S/C4H8O5/c5-1-2(6)3(7)4(8)9/h2-3,5-7H,1H2,(H,8,9)/t2-,3+/m1/s1
InChI key:InChIKey=JPIJQSOTBSSVTP-GBXIJSLDSA-N
SMILES:[C@H]([C@@H](CO)O)(C(O)=O)O
Synonyms:- Butanoic acid, 2,3,4-trihydroxy-, (2S,3R)-
- (2S,3R)-2,3,4-Trihydroxybutanoic acid
- Butanoic acid, 2,3,4-trihydroxy-, [S-(R*,S*)]-
- Threonic acid, D-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
D-Threonic acid lithium salt
CAS:D-Threonic acid lithium salt is a cell signaling molecule that belongs to the class of ligands. It has been used as a research tool in pharmacology and protein interaction studies. D-Threonic acid lithium salt can activate ion channels, which are cellular membrane proteins that allow ions to flow in or out of cells. D-Threonic acid lithium salt also interacts with receptors, which are proteins on the surface of cells that receive chemical signals from outside the cells. Receptors can be either agonists or antagonists. D-Threonic acid lithium salt is a ligand for receptor tyrosine kinase, which is involved in cell growth and differentiation.
Formula:C4H8O5·LiPurity:Min. 95%Ref: 3D-VAA24626
Discontinued product
