CAS 2026-16-6

2-Vinylanthracene

Description:

2-Vinylanthracene is an organic compound classified as a polycyclic aromatic hydrocarbon (PAH). It features a vinyl group (-CH=CH2) attached to the anthracene structure, which consists of three fused benzene rings. This compound is typically a solid at room temperature and exhibits a yellow to brown color. 2-Vinylanthracene is known for its photochemical properties, making it useful in various applications, including organic electronics and as a fluorescent probe in research. It has a relatively high melting point and is soluble in organic solvents such as benzene and toluene, but has limited solubility in water. The compound can undergo polymerization under UV light, leading to the formation of polyvinyl derivatives. Due to its structure, 2-vinylanthracene can participate in various chemical reactions, including electrophilic aromatic substitution and addition reactions. As with many PAHs, it is important to handle this compound with care due to potential health and environmental concerns associated with its derivatives.

Formula: C₁₆H₁₂

InChI: InChI=1/C16H12/c1-2-12-7-8-15-10-13-5-3-4-6-14(13)11-16(15)9-12/h2-11H,1H2

SMILES: C=Cc1ccc2cc3ccccc3cc2c1

Synonyms:

• 2-Ethenylanthracene

2-Vinylanthracene

CAS: 2026-16-6

Formula: C₁₆H₁₂

Color and Shape: Solid

Molecular weight: 204.2665

Ref: IN-DA0028BU

2-Vinylanthracene

Controlled Product

CAS: 2026-16-6

Applications Used in cationic polymerization.
References Wim, D., et al.: Synthesis, 2, 201 (1996)

Formula: C₁₆H₁₂

Color and Shape: Neat

Molecular weight: 204.27

Ref: TR-V368750