CAS 2026-28-0
:9,10-Anthracenediol, 2-ethyl-9,10-dihydro-
Description:
9,10-Anthracenediol, 2-ethyl-9,10-dihydro- is an organic compound characterized by its structure, which includes an anthracene backbone with hydroxyl groups at the 9 and 10 positions and an ethyl group substituent. This compound is a derivative of anthracene, a polycyclic aromatic hydrocarbon, and exhibits properties typical of such structures, including potential fluorescence and hydrophobicity. The presence of hydroxyl groups introduces polar characteristics, which can enhance solubility in certain solvents and influence reactivity. It may participate in hydrogen bonding due to the hydroxyl groups, affecting its physical properties and interactions with other molecules. The compound is of interest in various fields, including organic synthesis and materials science, due to its potential applications in organic electronics and as a precursor for further chemical modifications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C16H16O2
InChI:InChI=1S/C16H16O2/c1-2-10-7-8-13-14(9-10)16(18)12-6-4-3-5-11(12)15(13)17/h3-9,15-18H,2H2,1H3
InChI key:InChIKey=BCOIBXZDUNKNNS-UHFFFAOYSA-N
SMILES:OC1C=2C(C(O)C=3C1=CC=CC3)=CC=C(CC)C2
Synonyms:- 2-Ethyl-9,10-dihydro-9,10-dihydroxyanthracene
- 2-Ethyl-9,10-dihydroanthracene-9,10-diol
- 9,10-Anthracenediol, 2-ethyl-9,10-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
