CAS 20261-38-5: Ginkgoneolic acid
Description:Ginkgoneolic acid, with the CAS number 20261-38-5, is a chemical compound derived from the Ginkgo biloba tree, known for its medicinal properties. It is classified as a diterpenoid and is one of the bioactive constituents found in ginkgo leaves. This compound exhibits various biological activities, including antioxidant properties, which contribute to its potential health benefits. Ginkgoneolic acid is often studied for its effects on cognitive function and circulation, as it may enhance blood flow and protect against oxidative stress. The substance is typically characterized by its relatively low solubility in water but higher solubility in organic solvents, which is common for many terpenoids. Additionally, it has been investigated for its role in traditional medicine and as a dietary supplement. However, like many natural compounds, its efficacy and safety profile can vary, necessitating further research to fully understand its therapeutic potential and mechanisms of action.
Formula:C20H32O3
InChI:InChI=1S/C20H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-14-17-15-13-16-18(21)19(17)20(22)23/h13,15-16,21H,2-12,14H2,1H3,(H,22,23)
InChI key:InChIKey=VEPUCZUJLKAVNM-UHFFFAOYSA-N
SMILES:O=C(O)C=1C(O)=CC=CC1CCCCCCCCCCCCC
- Synonyms:
- 2-Hydroxy-6-Tridecylbenzoic Acid
- 6-Tridecylsalicylic acid
- Benzoic acid, 2-hydroxy-6-tridecyl-
- Ginkgolic Acid (C13:0)
- Ginkgolic acid 13:0
- Ginkgoneolic acid
- Salicylic acid, 6-tridecyl-
- 6-n-Tridecylsalicylic acid
