CAS 20263-06-3
:2-Amino-3-phosphonopropionic acid
Description:
2-Amino-3-phosphonopropionic acid (CAS 20263-06-3) is an organophosphorus compound characterized by its amino acid structure, which includes a phosphonic acid group. This compound is a non-proteinogenic amino acid, meaning it is not incorporated into proteins during translation. It features a central carbon atom bonded to an amino group (-NH2), a carboxylic acid group (-COOH), and a phosphonic acid group (-PO3H2), making it a phosphonic analog of the amino acid alanine. 2-Amino-3-phosphonopropionic acid is known for its role as a neurotransmitter and is often studied for its potential neuroprotective properties. It is soluble in water, which facilitates its use in biological studies. The compound is of interest in various fields, including biochemistry and pharmacology, due to its structural similarity to glutamate, a key neurotransmitter in the central nervous system. Its unique properties make it a valuable tool in research related to neurobiology and potential therapeutic applications.
Formula:C3H8NO5P
InChI:InChI=1S/C3H8NO5P/c4-2(3(5)6)1-10(7,8)9/h2H,1,4H2,(H,5,6)(H2,7,8,9)
InChI key:InChIKey=LBTABPSJONFLPO-UHFFFAOYSA-N
SMILES:C(CP(=O)(O)O)(C(O)=O)N
Synonyms:- 3-Phosphonoalanine
- Alanine, 3-phosphono-
- 2-Amino-3-phosphonopropionic acid
- α-Amino-β-phosphonopropionic acid
- Phosphonic acid, (2-amino-2-carboxyethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
DL-AP3
CAS:DL-AP3 is a competitive group I metabotropic glutamate receptor antagonist and inhibitor of phosphoserine phosphatase.Formula:C3H8NO5PPurity:98.18% - ≥98%Color and Shape:White PowderMolecular weight:169.07DL-2-Amino-3-phosphonopropionic acid
CAS:DL-2-Amino-3-phosphonopropionic acid is a natural compound that has been shown to have an effect on locomotor activity and the release of cortisol in rats. It also has a metal chelate, which may be responsible for its antioxidant properties. DL-2-Amino-3-phosphonopropionic acid is synthesized by asymmetric synthesis, which is a chemical reaction that produces the chiral form of the compound. This process requires an inorganic acid and cation channel. DL-2-Amino-3-phosphonopropionic acid has been found to have physiological functions such as matrix effects and regulating light exposure. The optimum pH for this compound is 7.4.
Formula:C3H8NO5PPurity:Min. 95%Molecular weight:169.07 g/mol


