CAS 20263-07-4
:2-Amino-4-phosphonobutanoic acid
Description:
2-Amino-4-phosphonobutanoic acid, commonly referred to as APB, is an amino acid derivative characterized by the presence of both an amino group and a phosphonic acid group. This compound is notable for its role as a selective agonist of the metabotropic glutamate receptor, particularly in research related to neurobiology and pharmacology. Structurally, it features a four-carbon backbone with an amino group located at the second carbon and a phosphonobutanoic acid moiety at the fourth carbon. APB is typically a white crystalline solid that is soluble in water, making it suitable for various biological applications. Its unique structure allows it to interact with neurotransmitter systems, influencing synaptic transmission and neuronal signaling. Additionally, due to its phosphonic acid group, it exhibits properties similar to phosphoric acid derivatives, which can be relevant in biochemical pathways. Overall, 2-Amino-4-phosphonobutanoic acid serves as a valuable tool in scientific research, particularly in studies involving glutamate receptors and their associated pathways.
Formula:C4H10NO5P
InChI:InChI=1S/C4H10NO5P/c5-3(4(6)7)1-2-11(8,9)10/h3H,1-2,5H2,(H,6,7)(H2,8,9,10)
InChI key:InChIKey=DDOQBQRIEWHWBT-UHFFFAOYSA-N
SMILES:C(C(C(O)=O)N)CP(=O)(O)O
Synonyms:- (±)-2-Amino-4-phosphonobutyric acid
- 2-Amino-4-phosphonobutanoic acid
- 3-Amino-3-carboxypropylphosphonic acid
- <span class="text-smallcaps">DL</span>-(±)-2-Amino-4-phosphonobutyric acid
- <span class="text-smallcaps">DL</span>-2-Amino-4-phosphonobutanoic acid
- Butanoic acid, 2-amino-4-phosphono-
- Butyric acid, 2-amino-4-phosphono-
- NSC 30079
- NSC 354086
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
DL-2-Amino-4-phosphonobutyric acid, 95%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C4H10NO5PPurity:95%Color and Shape:White, PowderMolecular weight:183.1DL-2-Amino-4-phosphonobutyric acid
CAS:Formula:C4H10NO5PPurity:95%Color and Shape:SolidMolecular weight:183.0997AP-4
CAS:AP-4 is an antagonist of the NMDA glutamate receptor.Formula:C4H10NO5PColor and Shape:SolidMolecular weight:183.1



