CAS 20271-20-9

methyl 4-nitro-1H-imidazole-5-carboxylate

Description:

Methyl 4-nitro-1H-imidazole-5-carboxylate is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a nitro group (-NO2) at the 4-position and a carboxylate group (-COOCH3) at the 5-position, contributing to its reactivity and potential applications in organic synthesis. It is typically a yellow to orange crystalline solid, exhibiting moderate solubility in polar organic solvents. The presence of the nitro group enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Methyl 4-nitro-1H-imidazole-5-carboxylate can serve as a building block in the synthesis of pharmaceuticals and agrochemicals. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on environmental conditions and purity. As with many nitro compounds, it should be handled with care due to potential toxicity and environmental impact.

Formula: C₅H₅N₃O₄

InChI: InChI=1/C5H5N3O4/c1-12-5(9)3-4(8(10)11)7-2-6-3/h2H,1H3,(H,6,7)

SMILES: COC(=O)c1c([nH]cn1)N(=O)=O

1H-Imidazole-4-carboxylic acid, 5-nitro-, methyl ester

CAS: 20271-20-9

Formula: C₅H₅N₃O₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 171.1109

Ref: IN-DA0028DO

Methyl 5-Nitroimidazole-4-carboxylate

CAS: 20271-20-9

Methyl 5-Nitroimidazole-4-carboxylate

Purity: ≥95%

Molecular weight: 171.11g/mol

Ref: 54-OR471087

METHYL 5-NITRO-1H-IMIDAZOLE-4-CARBOXYLATE

CAS: 20271-20-9

Formula: C₅H₅N₃O₄

Purity: 98%

Molecular weight: 171.112

Ref: 10-F389811

Methyl 5-nitro-1H-imidazole-4-carboxylate

CAS: 20271-20-9

Versatile small molecule scaffold

Formula: C₅H₅N₃O₄

Purity: Min. 95%

Molecular weight: 171.11 g/mol

Ref: 3D-VAA27120