CAS 202745-73-1
:1-methyl-1H-indole-6-carboxylic acid
Description:
1-Methyl-1H-indole-6-carboxylic acid is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. This compound features a methyl group at the nitrogen atom of the indole ring and a carboxylic acid functional group at the 6-position. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The indole moiety contributes to its potential biological activity, as indole derivatives are known for their roles in pharmaceuticals and natural products. This compound may exhibit solubility in polar solvents due to the carboxylic acid group, while the indole structure can influence its lipophilicity. Additionally, 1-methyl-1H-indole-6-carboxylic acid may serve as a building block in organic synthesis or as a precursor in the development of more complex molecules. Its unique structural features make it of interest in medicinal chemistry and materials science.
Formula:C10H9NO2
InChI:InChI=1/C10H9NO2/c1-11-5-4-7-2-3-8(10(12)13)6-9(7)11/h2-6H,1H3,(H,12,13)
SMILES:Cn1ccc2ccc(cc12)C(=O)O
Synonyms:- 1H-indole-6-carboxylic acid, 1-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-METHYL-1H-INDOLE-6-CARBOXYLIC ACID
CAS:Formula:C10H9NO2Purity:95%Color and Shape:SolidMolecular weight:175.1871H-Indole-6-carboxylic acid, 1-methyl-
CAS:Formula:C10H9NO2Purity:98%Color and Shape:SolidMolecular weight:175.18401-Methyl-1H-indole-6-carboxylic acid
CAS:1-Methyl-1H-indole-6-carboxylic acidFormula:C10H9NO2Purity:97%Color and Shape: pale yellow solidMolecular weight:175.18g/mol1-Methylindole-6-carboxylic acid
CAS:1-Methylindole-6-carboxylic acid is a versatile building block that is used in the synthesis of more complex compounds. It can be used as a reagent, speciality chemical, and useful building block for pharmaceuticals and other research chemicals. 1-Methylindole-6-carboxylic acid has been shown to be an effective intermediate for the production of a number of different compounds. The compound can also act as a reaction component or scaffold for chemical reactions.Formula:C10H9NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:175.18 g/mol



