CymitQuimica logo

CAS 202753-56-8

:

2-(4-bromo-1H-indol-3-yl)ethanol

Description:
2-(4-bromo-1H-indol-3-yl)ethanol, with the CAS number 202753-56-8, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 4-position of the indole ring contributes to its reactivity and potential biological activity. The ethanol moiety indicates that the compound has a hydroxyl (-OH) group, which enhances its solubility in polar solvents and may influence its interaction with biological targets. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, including effects on neurotransmitter systems. Its structural features suggest that it may participate in hydrogen bonding and other intermolecular interactions, which are critical for its biological function. Additionally, the bromine substituent can affect the electronic properties of the molecule, potentially influencing its reactivity and binding affinity in various chemical and biological contexts.
Formula:C10H10BrNO
InChI:InChI=1/C10H10BrNO/c11-8-2-1-3-9-10(8)7(4-5-13)6-12-9/h1-3,6,12-13H,4-5H2
InChI key:UQTDRZYOUJTQQB-UHFFFAOYSA-N
SMILES:c1cc(c2c(CCO)c[nH]c2c1)Br
Synonyms:
  • 1H-indole-3-ethanol, 4-bromo-
  • 4-Bromotryptophol
  • 2-(4-Bromo-1H-indol-3-yl)ethanol
Found 4 products.