CAS 2028-12-8
:6-carbamoylcyclohex-3-ene-1-carboxylic acid
Description:
6-Carbamoylcyclohex-3-ene-1-carboxylic acid, identified by its CAS number 2028-12-8, is an organic compound characterized by its cyclohexene structure, which features a carboxylic acid and a carbamoyl functional group. This compound typically exhibits properties associated with both cyclic and aromatic systems, including potential reactivity due to the presence of the double bond in the cyclohexene ring. The carboxylic acid group contributes to its acidity and solubility in polar solvents, while the carbamoyl group can participate in hydrogen bonding, influencing its interactions with other molecules. The compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthetic pathways. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it a subject of study in organic synthesis and chemical reactivity. Overall, 6-carbamoylcyclohex-3-ene-1-carboxylic acid represents a versatile structure with implications in both theoretical and applied chemistry.
Formula:C8H11NO3
InChI:InChI=1/C8H11NO3/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-2,5-6H,3-4H2,(H2,9,10)(H,11,12)
SMILES:C1=CCC(C(C1)C(=N)O)C(=O)O
Synonyms:- 3-Cyclohexene-1-carboxylic acid, 6-(aminocarbonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1,2,3,6-Tetrahydrophthalamic acid
CAS:Formula:C8H11NO3Color and Shape:Off White SolidMolecular weight:169.1786-(Aminocarbonyl)-3-cyclohexene-1-carboxylic Acid
CAS:Controlled Product<p>Applications 6-(Aminocarbonyl)-3-cyclohexene-1-carboxylic Acid is a useful building block for organic synthesis.<br></p>Formula:C8H11NO3Color and Shape:NeatMolecular weight:169.178

