CAS 202817-08-1

2-(2-isopropylthiazol-4-yl)ethanamine

Description:

2-(2-Isopropylthiazol-4-yl)ethanamine, with the CAS number 202817-08-1, is a chemical compound characterized by its thiazole ring structure, which contributes to its biological activity. This compound features an isopropyl group attached to the thiazole, enhancing its lipophilicity and potentially influencing its interaction with biological targets. The ethanamine moiety provides basic amine functionality, which can participate in hydrogen bonding and may affect its solubility and reactivity. Typically, compounds of this nature are studied for their pharmacological properties, including potential applications in medicinal chemistry. The presence of the thiazole ring often suggests possible antimicrobial or antifungal activities, as thiazole derivatives are known for their diverse biological effects. Additionally, the structural features of this compound may allow for modifications that can optimize its efficacy and selectivity in various applications. As with many organic compounds, its stability, reactivity, and interactions with other substances would depend on environmental conditions such as pH and temperature.

Formula: C₈H₁₄N₂S

InChI: InChI=1/C8H14N2S/c1-6(2)8-10-7(3-4-9)5-11-8/h5-6H,3-4,9H2,1-2H3

SMILES: CC(C)c1nc(CCN)cs1

Synonyms:

• 2-[2-(Propan-2-Yl)-1,3-Thiazol-4-Yl]Ethanamine
• 4-Thiazoleethanamine, 2-(1-Methylethyl)-