CAS 20282-39-7
:2,5-dimethyl-1-propyl-1H-pyrrole
Description:
2,5-Dimethyl-1-propyl-1H-pyrrole is an organic compound characterized by its pyrrole ring, which is a five-membered aromatic heterocycle containing one nitrogen atom. The presence of two methyl groups at the 2 and 5 positions, along with a propyl group at the 1 position, contributes to its unique structural and chemical properties. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents and exhibits moderate stability under standard conditions. The presence of the nitrogen atom in the pyrrole ring imparts basicity, allowing it to participate in various chemical reactions, including electrophilic substitutions. Additionally, 2,5-dimethyl-1-propyl-1H-pyrrole may exhibit biological activity, making it of interest in fields such as medicinal chemistry and materials science. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C9H15N
InChI:InChI=1/C9H15N/c1-4-7-10-8(2)5-6-9(10)3/h5-6H,4,7H2,1-3H3
SMILES:CCCn1c(C)ccc1C
Synonyms:- 1H-pyrrole, 2,5-dimethyl-1-propyl-
- 2,5-Dimethyl-1-propylpyrrole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2,5-Dimethyl-1-propyl-1H-pyrrole
CAS:<p>2,5-Dimethyl-1-propyl-1H-pyrrole is an antineoplastic drug that belongs to the class of amides. It is used in the treatment of infant leukemia, a cancer of the blood and bone marrow. The long duration of this drug has been shown to be effective in women with chronic myelogenous leukemia who have a high risk for relapse after chemotherapy. 2,5-Dimethyl-1-propyl-1H-pyrrole can cause neutropenia and other side effects such as skin rash and diarrhea. This drug binds to nucleophilic sites on proteins and inhibits protein synthesis by preventing the formation of dihedral angles in five membered rings. 2,5-Dimethyl-1-propyl-1H-pyrrole also has antipyrine activity, which means it inhibits the production of prostaglandins by blocking their synthesis at the cyclooxygenase level. It can also inhibit the</p>Formula:C9H15NPurity:Min. 95%Molecular weight:137.22 g/mol
