CAS 20282-75-1: Diorcinol

Description:Diorcinol, identified by the CAS number 20282-75-1, is a chemical compound that belongs to the class of organic compounds known as phenols. It is characterized by the presence of multiple hydroxyl (-OH) groups attached to aromatic rings, which contributes to its reactivity and potential applications in various fields. Diorcinol typically exhibits properties such as solubility in organic solvents and moderate solubility in water, depending on the specific structure and substituents present. The compound may display antioxidant properties due to its phenolic nature, making it of interest in pharmaceuticals and materials science. Additionally, diorcinol can participate in various chemical reactions, including oxidation and substitution, which can be leveraged in synthetic organic chemistry. Its safety profile and environmental impact would need to be assessed in accordance with regulatory guidelines, as with any chemical substance. Overall, diorcinol's unique structural features and reactivity make it a subject of interest for further research and potential applications.

Formula:C₁₄H₁₄O₃

InChI:InChI=1S/C14H14O3/c1-9-3-11(15)7-13(5-9)17-14-6-10(2)4-12(16)8-14/h3-8,15-16H,1-2H3

InChI key:InChIKey=SPCJQQBYWVGMQG-UHFFFAOYSA-N

SMILES:OC=1C=C(OC2=CC(O)=CC(=C2)C)C=C(C1)C

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Diorcinol REF: 8R-CL0559CAS: 20282-75-1	94.37%	To inquire	Fri 21 Mar 25
Diorcinol REF: TM-T125409CAS: 20282-75-1	- - -	To inquire	Wed 26 Mar 25
Dyorcinol REF: 3D-FD180831CAS: 20282-75-1	Min. 95%	- - -	Discontinued product