CAS 202823-24-3
:(5-chloro-2-methoxyphenyl)hydrazine
Description:
(5-Chloro-2-methoxyphenyl)hydrazine is an organic compound characterized by its hydrazine functional group attached to a substituted phenyl ring. The presence of a chlorine atom at the 5-position and a methoxy group at the 2-position of the phenyl ring contributes to its unique chemical properties. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its potential applications in pharmaceuticals and agrochemicals. The hydrazine moiety is often associated with reactivity, particularly in forming hydrazones and other derivatives through condensation reactions. Additionally, the chlorine and methoxy substituents can influence the compound's solubility, stability, and reactivity, making it a subject of interest in synthetic organic chemistry. Safety considerations are important when handling this compound, as hydrazines can be toxic and potentially carcinogenic. Proper laboratory practices should be followed to mitigate risks associated with exposure.
Formula:C7H10Cl2N2O
InChI:InChI=1/C7H9ClN2O.ClH/c1-11-7-3-2-5(8)4-6(7)10-9;/h2-4,10H,9H2,1H3;1H
SMILES:COc1ccc(cc1NN)Cl.Cl
Synonyms:- (5-Chloro-2-methoxyphenyl)hydrazine hydrochloride (1:1)
- Hydrazine, (5-chloro-2-methoxyphenyl)-, hydrochloride (1:1)
- hydrazine, (5-chloro-2-methoxyphenyl)-
- 5-Chloro-2-Methoxyphenylhydrazine Hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
