CAS 202826-52-6

spiro[1,3-dihydroquinazoline-2,4'-piperidine]-4-one

Description:

Spiro[1,3-dihydroquinazoline-2,4'-piperidine]-4-one is a heterocyclic compound characterized by its unique spirocyclic structure, which consists of a quinazoline moiety fused to a piperidine ring. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry. The presence of both nitrogen-containing rings contributes to its potential as a pharmacophore, which can interact with various biological targets. The compound may display properties such as moderate to high solubility in organic solvents, and its stability can be influenced by environmental factors such as pH and temperature. Additionally, the spiro configuration often imparts unique steric and electronic properties that can affect its reactivity and interaction with other molecules. Overall, spiro[1,3-dihydroquinazoline-2,4'-piperidine]-4-one represents a class of compounds that are valuable for further research in drug development and synthetic chemistry.

Formula: C₁₂H₁₅N₃O

InChI: InChI=1/C12H15N3O/c16-11-9-3-1-2-4-10(9)14-12(15-11)5-7-13-8-6-12/h1-4,13-14H,5-8H2,(H,15,16)

Synonyms:

• 1'H-Spiro[piperidine-4,2'-quinazolin]-4'(3'H)-one
• spiro[piperidine-4,2'(1'H)-quinazolin]-4'(3'H)-one

1'H-Spiro[piperidine-4,2'-quinazolin]-4'(3'H)-one

CAS: 202826-52-6

Formula: C₁₂H₁₅N₃O

Molecular weight: 217.2670

Ref: IN-DA0028H2

1'H-Spiro[piperidine-4,2'-quinazolin]-4'(3'H)-one

CAS: 202826-52-6

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 217.27200317382812

Ref: 10-F077539