CAS 202865-59-6

2-Bromo-4,6-difluoroanisole

Description:

2-Bromo-4,6-difluoroanisole is an organic compound characterized by its aromatic structure, which includes a methoxy group (-OCH₃) and halogen substituents. The presence of bromine and fluorine atoms on the aromatic ring significantly influences its chemical properties, including reactivity and polarity. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions, such as nucleophilic substitutions and electrophilic aromatic substitutions. The fluorine atoms enhance its lipophilicity and stability, while the bromine atom can serve as a leaving group in reactions. Additionally, 2-Bromo-4,6-difluoroanisole may exhibit specific biological activities, making it of interest in medicinal chemistry. As with many halogenated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns.

Formula: C₇H₅BrF₂O

InChI: InChI=1/C7H5BrF2O/c1-11-7-5(8)2-4(9)3-6(7)10/h2-3H,1H3

SMILES: COc1c(cc(cc1F)F)Br

Synonyms:

• 1-Bromo-3,5-difluoro-2-methoxybenzene
• 202865-59-6
• 2-Bromo-4,6-difluorophenyl methyl ether
• Benzene, 1-bromo-3,5-difluoro-2-methoxy-
• Fr Cf Ee Do1

Benzene, 1-bromo-3,5-difluoro-2-methoxy-

CAS: 202865-59-6

Formula: C₇H₅BrF₂O

Purity: 98%

Color and Shape: Liquid

Molecular weight: 223.0148

Ref: IN-DA0028HN

2-Bromo-4,6-difluoroanisole

CAS: 202865-59-6

2-Bromo-4,6-difluoroanisole

Formula: C₇H₅BrF₂O

Purity: 99%

Color and Shape: Colourless Liquid

Molecular weight: 223.01g/mol

Ref: 54-PC0038

2-Bromo-4,6-difluoroanisole

CAS: 202865-59-6

Formula: C₇H₅BrF₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 223.017

Ref: 10-F013195