CAS 202865-85-8

2-Bromo-5-iodotoluene

Description:

2-Bromo-5-iodotoluene is an organic compound characterized by the presence of both bromine and iodine substituents on a toluene ring. Specifically, the bromine atom is located at the second position and the iodine atom at the fifth position of the aromatic ring, which contributes to its unique reactivity and properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its applications in organic synthesis, particularly in the preparation of more complex molecules through various coupling reactions. The presence of both halogens can enhance its reactivity, making it a useful intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, 2-Bromo-5-iodotoluene may exhibit varying degrees of solubility in organic solvents, and its handling requires standard safety precautions due to the potential hazards associated with halogenated compounds. Overall, its structural features and reactivity make it a valuable compound in the field of synthetic organic chemistry.

Formula: C₇H₆BrI

InChI: InChI=1/C7H6BrI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3

SMILES: Cc1cc(ccc1Br)I

Synonyms:

• 1-Bromo-4-Iodo-2-Methylbenzene

2-Bromo-5-iodotoluene

CAS: 202865-85-8

Formula: C₇H₆BrI

Purity: >98.0%(GC)

Color and Shape: Colorless to Yellow to Orange clear liquid

Molecular weight: 296.93

Ref: 3B-B3099

Benzene, 1-bromo-4-iodo-2-methyl-

CAS: 202865-85-8

Formula: C₇H₆BrI

Purity: 98%

Color and Shape: Liquid

Molecular weight: 296.9310

Ref: IN-DA0028I3

2-Bromo-5-iodotoluene

CAS: 202865-85-8

2-Bromo-5-iodotoluene

Formula: C₇H₆BrI

Purity: 98%

Color and Shape: clear. light yellow/light green liquid

Molecular weight: 296.93g/mol

Ref: 54-OR4591

2-Bromo-5-iodotoluene

CAS: 202865-85-8

2-Bromo-5-iodotoluene (2BIOT) is a synthetic compound that has been used as an immunosorbent in immunoassays. It is also a fluorescing radical and can be used to detect other radicals, making it useful for many different types of assays. The compound was first synthesized by the reaction of sodium periodate with 2-bromotoluene; the reaction was catalyzed by radical mechanism. This synthesis is an advance in organic chemistry because it provides a new method for synthesizing brominated compounds.

Formula: C₇H₆BrI

Purity: Min. 95%

Color and Shape: Slightly Yellow Powder

Molecular weight: 296.93 g/mol

Ref: 3D-FB70579

2-Bromo-5-iodotoluene

CAS: 202865-85-8

Formula: C₇H₆BrI

Purity: 98%

Color and Shape: Liquid

Molecular weight: 296.933

Ref: 10-F018282