CAS 20289-44-5: 4H-Pyrazolo[3,4-d]pyrimidin-4-amine
Description:4H-Pyrazolo[3,4-d]pyrimidin-4-amine, with the CAS number 20289-44-5, is a heterocyclic organic compound characterized by its pyrazolo and pyrimidine ring structures. This compound typically exhibits a fused bicyclic system, which contributes to its unique chemical properties. It is known for its potential biological activity, often being investigated for its role in medicinal chemistry, particularly as a scaffold for developing pharmaceuticals. The presence of the amino group at the 4-position of the pyrazolo ring enhances its reactivity and solubility in various solvents. Additionally, this compound may participate in hydrogen bonding due to the amino group, influencing its interactions with biological targets. Its structural features allow for various modifications, making it a versatile compound in research. Overall, 4H-Pyrazolo[3,4-d]pyrimidin-4-amine is of interest in both synthetic and medicinal chemistry due to its potential applications in drug development and its intriguing chemical behavior.
Formula:C5H5N5
InChI:InChI=1S/C5H5N5/c6-4-3-1-9-10-5(3)8-2-7-4/h1-2,4H,6H2
InChI key:InChIKey=VAOHIJMLMILFFA-UHFFFAOYSA-N
SMILES:N1=NC2=NC=NC(N)C2=C1
- Synonyms:
- 1H-pyrazolo[3,4-d]pyrimidin-4-amine
- 4-amino-pyrazolo(3,4-D)pyrimidine
- 4H-Pyrazolo[3,4-d]pyrimidine, 4-amino-
- 4H-pyrazolo[3,4-d]pyrimidin-4-amine
- 8-Aza-7-Deazaadenine
- Aminopyrazolodpyrimidine
- 4-aminopyrazolo(3,4-D)pyrimidine

4-Aminopyrazolo[3,4-d]pyrimidine
Ref: 3B-A1041
1g | 77.00 € | ||
5g | 228.00 € | ||
100mg | 27.00 € |

4H-Pyrazolo[3,4-d]pyrimidin-4-amine
Ref: IN-DA0028JC
Undefined size | To inquire |

4-Amino-4H-pyrazolo[3,4-d]pyrimidine
Ref: 3D-FA15519
5g | 147.00 € | ||
25g | 147.00 € |