CAS 20290-75-9: Stearidonic acid
Description:Stearidonic acid is a polyunsaturated fatty acid belonging to the omega-3 family, characterized by its four double bonds, specifically positioned at the 3, 6, 9, and 12 carbon atoms. It is a colorless to pale yellow liquid at room temperature and is insoluble in water but soluble in organic solvents. This fatty acid is primarily found in certain plant oils, such as hemp seed oil and echium oil, and plays a significant role in human nutrition due to its potential health benefits, including anti-inflammatory properties and cardiovascular health support. Stearidonic acid serves as a precursor to other longer-chain omega-3 fatty acids, such as eicosapentaenoic acid (EPA) and docosahexaenoic acid (DHA), which are crucial for various physiological functions. Its molecular formula is C18H30O2, and it has a molecular weight of approximately 282.43 g/mol. Due to its beneficial effects, stearidonic acid is of interest in dietary supplements and functional foods aimed at improving overall health and wellness.
Formula:C18H28O2
InChI:InChI=1S/C18H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10,12-13H,2,5,8,11,14-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9-,13-12-
InChI key:InChIKey=JIWBIWFOSCKQMA-LTKCOYKYSA-N
SMILES:O=C(O)CCCCC=CCC=CCC=CCC=CCC
- Synonyms:
- (6Z,9Z,12Z,15Z)-6,9,12,15-Octadecatetraenoic acid
- (6Z,9Z,12Z,15Z)-Octadecatetraenoic acid
- (Z,Z,Z,Z)-6,9,12,15-Octadecatetraenoic acid
- (all-Z)-6,9,12,15-Octadecatetraenoic acid
- 18:4(N-3)
- 6,9,12,15-Octadecatetraenoic acid, (6Z,9Z,12Z,15Z)-
- 6,9,12,15-Octadecatetraenoic acid, (all-Z)-
- 6,9,12,15-Octadecatetraenoicacid, (all-Z)- (8CI)
- 6,9,12,15-cis-Octadecatetraenoic acid
- D6,9,12,15-Octadecatetraenoic acid
- See more synonyms
- Moroctic acid
- Stearidonic acid
- all-cis-6,9,12,15-Octadecatetraenoic acid
- Δ<sup>6,9,12,15</sup>-Octadecatetraenoic acid
