CAS 20291-74-1

1,6-dimethylphenanthrene

Description:

1,6-Dimethylphenanthrene is a polycyclic aromatic hydrocarbon (PAH) characterized by its structure, which consists of a phenanthrene backbone with two methyl groups attached at the 1 and 6 positions. This compound is typically a solid at room temperature and exhibits a high melting point due to its stable aromatic structure. It is insoluble in water but soluble in organic solvents, which is a common trait among PAHs. 1,6-Dimethylphenanthrene is known for its potential environmental persistence and can be found in fossil fuels and as a byproduct of combustion processes. Its chemical behavior is influenced by the presence of the methyl groups, which can affect its reactivity and interactions with other substances. Additionally, like many PAHs, it may pose health risks, including carcinogenicity, depending on exposure levels. Due to these properties, 1,6-dimethylphenanthrene is of interest in environmental chemistry and toxicology studies.

Formula: C₁₆H₁₄

InChI: InChI=1/C16H14/c1-11-6-7-13-8-9-14-12(2)4-3-5-15(14)16(13)10-11/h3-10H,1-2H3

SMILES: Cc1ccc2ccc3c(C)cccc3c2c1

Synonyms:

• Phenanthrene, 1,6-Dimethyl-

Phenanthrene, 1,6-dimethyl-

CAS: 20291-74-1

Formula: C₁₆H₁₄

Molecular weight: 206.2824

Ref: IN-DA0028IU

1,6-Dimethyl-phenanthrene

Controlled Product

CAS: 20291-74-1

Formula: C₁₆H₁₄

Color and Shape: Neat

Molecular weight: 206.282

Ref: TR-D476630

1,6-Dimethyl-phenanthrene

CAS: 20291-74-1

1,6-Dimethyl-phenanthrene is an organic compound that has been shown to be a potent activator of the Ah receptor. This receptor is involved in mediating the effects of the endogenous ligand arachidonic acid and therefore plays a role in inflammation and other responses. 1,6-Dimethyl-phenanthrene is synthesized by methylation of benzo[e]pyrene, which occurs naturally in the environment. This process involves chemical activation by energy input, such as diffraction or crystal x-ray diffraction. 1,6-Dimethyl-phenanthrene has been shown to have high potency against benthic invertebrates and is used as a standard for comparing potency in other compounds.

Formula: C₁₆H₁₄

Purity: Min. 95%

Molecular weight: 206.28 g/mol

Ref: 3D-VAA29174