CAS 20292-68-6: Ethanaminium, N,N,N-trimethyl-2-(1-oxobutoxy)-, perchlorate (1:1)

Description:Ethanaminium, N,N,N-trimethyl-2-(1-oxobutoxy)-, perchlorate (1:1), with the CAS number 20292-68-6, is an organic compound characterized by its quaternary ammonium structure, which includes a trimethylammonium group and a butoxy substituent. This compound typically exhibits properties associated with ionic liquids, such as low volatility and high thermal stability. The presence of the perchlorate anion contributes to its solubility in polar solvents and may impart specific reactivity, particularly in oxidative processes. The butoxy group enhances its hydrophobic characteristics, potentially influencing its interactions with biological membranes and other organic compounds. As a quaternary ammonium salt, it may also exhibit surfactant properties, making it useful in various applications, including pharmaceuticals, agrochemicals, and as a phase transfer catalyst. Safety considerations should be taken into account due to the potential toxicity of perchlorate salts, which can affect thyroid function in humans and animals. Overall, this compound's unique structure and properties make it of interest in both industrial and research contexts.

Formula:C₉H₂₀NO₂·ClO₄

InChI:InChI=1S/C9H20NO2.ClHO4/c1-5-6-9(11)12-8-7-10(2,3)4;2-1(3,4)5/h5-8H2,1-4H3;(H,2,3,4,5)/q+1;/p-1

InChI key:InChIKey=AOEDGUHNSUONPM-UHFFFAOYSA-M

SMILES:O=C(OCC[N+](C)(C)C)CCC.O=Cl(=O)(=O)[O-]