CAS 202932-04-5

(5-methylthiazol-2-yl)methanol

Description:

(5-Methylthiazol-2-yl)methanol is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of the methyl group at the 5-position of the thiazole ring contributes to its unique properties, while the methanol functional group (-CH2OH) enhances its reactivity and solubility in polar solvents. This compound is typically a solid at room temperature and may exhibit moderate to high polarity due to the hydroxymethyl group. It is often used in various chemical syntheses and may have applications in pharmaceuticals or agrochemicals, given the biological relevance of thiazole derivatives. The compound's molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₅H₇NOS

InChI: InChI=1/C5H7NOS/c1-4-2-6-5(3-7)8-4/h2,7H,3H2,1H3

SMILES: Cc1cnc(CO)s1

Synonyms:

• 2-Thiazolemethanol, 5-Methyl-
• (5-Methyl-1,3-Thiazol-2-Yl)Methanol

2-Thiazolemethanol, 5-methyl-

CAS: 202932-04-5

Formula: C₅H₇NOS

Purity: 97%

Color and Shape: Solid

Molecular weight: 129.1802

Ref: IN-DA0028KB

2-(Hydroxymethyl)-5-methyl-1,3-thiazole

CAS: 202932-04-5

2-(Hydroxymethyl)-5-methyl-1,3-thiazole

Formula: C₅H₇NOS

Purity: 95%

Color and Shape: clear. pale yellow solid

Molecular weight: 129.18g/mol

Ref: 54-OR2604

(5-Methyl-1,3-thiazol-2-yl)methanol

CAS: 202932-04-5

Formula: C₅H₇NOS

Purity: 97%

Color and Shape: Clear

Molecular weight: 129.18

Ref: 10-F067722