CAS 20295-34-5

cyclopropanecarbothioamide

Description:

Cyclopropanecarbothioamide is an organic compound characterized by its unique cyclopropane ring structure, which is a three-membered carbon ring. This compound features a carbothioamide functional group, where a carbon atom is bonded to a sulfur atom and an amine group (–NH2). The presence of the cyclopropane ring imparts distinctive strain and reactivity to the molecule, making it an interesting subject for synthetic and medicinal chemistry. Cyclopropanecarbothioamide is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents but may have limited solubility in water due to its hydrophobic cyclopropane structure. The compound can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, making it valuable in the synthesis of more complex molecules. Additionally, its potential biological activity is of interest, as compounds containing thiourea or thioamide functionalities often exhibit diverse pharmacological properties. Safety data should be consulted for handling, as with any chemical substance.

Formula: C₄H₇NS

InChI: InChI=1/C4H7NS/c5-4(6)3-1-2-3/h3H,1-2H2,(H2,5,6)

SMILES: C1CC1C(=N)S

Synonyms:

• CyclopropanethiocarboxaMide

Cyclopropanethiocarboxamide, 97%

CAS: 20295-34-5

Cyclopropanecarbothioamide is used for purification in single-step preparation of thiazolo [5, 4-b] pyridine-and thiazolo [5, 4-c] pyridine derivatives from chloronitropyridines and thioamides, or thioureas. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product

Formula: C₄H₇NS

Purity: 97%

Color and Shape: White to cream to yellow, Crystals or powder or crystalline powder

Molecular weight: 101.17

Ref: 02-H32315

Cyclopropanecarbothioamide

CAS: 20295-34-5

Formula: C₄H₇NS

Purity: 98%

Color and Shape: Solid

Molecular weight: 101.1701

Ref: IN-DA0028L0

Cyclopropanecarbothioic acid amide

CAS: 20295-34-5

Cyclopropanecarbothioic acid amide

Purity: 98%

Molecular weight: 101.17g/mol

Ref: 54-OR315182

CYCLOPROPANECARBOTHIOAMIDE

CAS: 20295-34-5

Formula: C₄H₇NS

Purity: 98%

Color and Shape: Solid, Crystalline Powder or Powder

Molecular weight: 101.17

Ref: 10-F332234