CAS 20295-34-5
:cyclopropanecarbothioamide
Description:
Cyclopropanecarbothioamide is an organic compound characterized by its unique cyclopropane ring structure, which is a three-membered carbon ring. This compound features a carbothioamide functional group, where a carbon atom is bonded to a sulfur atom and an amine group (–NH2). The presence of the cyclopropane ring imparts distinctive strain and reactivity to the molecule, making it an interesting subject for synthetic and medicinal chemistry. Cyclopropanecarbothioamide is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents but may have limited solubility in water due to its hydrophobic cyclopropane structure. The compound can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, making it valuable in the synthesis of more complex molecules. Additionally, its potential biological activity is of interest, as compounds containing thiourea or thioamide functionalities often exhibit diverse pharmacological properties. Safety data should be consulted for handling, as with any chemical substance.
Formula:C4H7NS
InChI:InChI=1/C4H7NS/c5-4(6)3-1-2-3/h3H,1-2H2,(H2,5,6)
SMILES:C1CC1C(=N)S
Synonyms:- CyclopropanethiocarboxaMide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Cyclopropanethiocarboxamide, 97%
CAS:Cyclopropanecarbothioamide is used for purification in single-step preparation of thiazolo [5, 4-b] pyridine-and thiazolo [5, 4-c] pyridine derivatives from chloronitropyridines and thioamides, or thioureas. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar productFormula:C4H7NSPurity:97%Color and Shape:White to cream to yellow, Crystals or powder or crystalline powderMolecular weight:101.17Cyclopropanecarbothioamide
CAS:Formula:C4H7NSPurity:98%Color and Shape:SolidMolecular weight:101.1701Cyclopropanecarbothioic acid amide
CAS:Cyclopropanecarbothioic acid amide
Purity:98%Molecular weight:101.17g/molCYCLOPROPANECARBOTHIOAMIDE
CAS:Formula:C4H7NSPurity:98%Color and Shape:Solid, Crystalline Powder or PowderMolecular weight:101.17



