CAS 20296-73-5

L-alanylglycylglycylglycylglycine

Description:

L-alanylglycylglycylglycylglycine, with the CAS number 20296-73-5, is a synthetic peptide composed of multiple amino acids, specifically a sequence of glycine and alanine residues. This compound is characterized by its relatively small size and the presence of both hydrophobic (alanine) and hydrophilic (glycine) amino acids, which can influence its solubility and interaction with biological systems. Peptides like L-alanylglycylglycylglycylglycine are often studied for their potential roles in biochemistry, including their function in protein synthesis, signaling pathways, and as building blocks for larger proteins. The presence of multiple glycine residues can impart flexibility to the peptide structure, while the alanine residue may contribute to stability and specific interactions in biological contexts. Additionally, this compound may exhibit unique properties such as specific binding affinities or biological activities, making it of interest in pharmaceutical and biochemical research. Its synthesis and characterization typically involve standard peptide synthesis techniques, and it may be used in various applications, including drug development and molecular biology studies.

Formula: C₁₁H₁₉N₅O₆

InChI: InChI=1/C11H19N5O6/c1-6(12)11(22)16-4-9(19)14-2-7(17)13-3-8(18)15-5-10(20)21/h6H,2-5,12H2,1H3,(H,13,17)(H,14,19)(H,15,18)(H,16,22)(H,20,21)/t6-/m0/s1

SMILES: C[C@@H](C(=NCC(=NCC(=NCC(=NCC(=O)O)O)O)O)O)N

Synonyms:

• glycine, L-alanylglycylglycylglycyl-
• L-Ala-Gly-Gly-Gly-Gly
• L-Alanylglycylglycylglycylglycine

H-Ala-Gly-Gly-Gly-Gly-OH

CAS: 20296-73-5

Please enquire for more information about H-Ala-Gly-Gly-Gly-Gly-OH including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₁H₁₉N₅O₆

Purity: Min. 95%

Molecular weight: 317.3 g/mol

Ref: 3D-FA108462